C22H26F3N9O2 — CID 139398051
4-[[1-(methylamino)cyclopropyl]methoxy]-6-[4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2-carboxamide (PubChem CID 139398051) has the molecular formula C22H26F3N9O2 and a molecular weight of 505.51 g/mol. Its IUPAC name is 4-[[1-(methylamino)cyclopropyl]methoxy]-6-[4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2-carboxamide.
| Compound Name | 4-[[1-(methylamino)cyclopropyl]methoxy]-6-[4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 139398051 |
| Molecular Formula | C22H26F3N9O2 |
| Molecular Weight | 505.51 g/mol |
| Exact Mass | 505.22 |
| IUPAC Name | 4-[[1-(methylamino)cyclopropyl]methoxy]-6-[4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)piperidin-1-yl]-N-(2,2,2-trifluoroethyl)-1,3,5-triazine-2-carboxamide |
| SMILES | CNC1(COc2nc(C(=O)NCC(F)(F)F)nc(N3CCC(c4c[nH]c5nccnc45)CC3)n2)CC1 |
| InChI | InChI=1S/C22H26F3N9O2/c1-26-21(4-5-21)12-36-20-32-17(18(35)30-11-22(23,24)25)31-19(33-20)34-8-2-13(3-9-34)14-10-29-16-15(14)27-6-7-28-16/h6-7,10,13,26H,2-5,8-9,11-12H2,1H3,(H,28,29)(H,30,35) |
| InChIKey | DGGBHYNCUKMNNQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.51 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |