C15H24N2 — CID 139398203
4-heptan-3-yl-2,3-dihydro-1H-quinoxaline (PubChem CID 139398203) has the molecular formula C15H24N2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 4-heptan-3-yl-2,3-dihydro-1H-quinoxaline.
| Compound Name | 4-heptan-3-yl-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 139398203 |
| Molecular Formula | C15H24N2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.19 |
| IUPAC Name | 4-heptan-3-yl-2,3-dihydro-1H-quinoxaline |
| SMILES | CCCCC(CC)N1CCNc2ccccc21 |
| InChI | InChI=1S/C15H24N2/c1-3-5-8-13(4-2)17-12-11-16-14-9-6-7-10-15(14)17/h6-7,9-10,13,16H,3-5,8,11-12H2,1-2H3 |
| InChIKey | LQCMXUMAHUNBAN-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |