C19H24N6O — CID 139398826
N'-[4-(1,5-dimethylpyrazol-4-yl)phenyl]-1-formyl-4-(methylamino)-3,6-dihydro-2H-pyridine-5-carboximidamide (PubChem CID 139398826) has the molecular formula C19H24N6O and a molecular weight of 352.44 g/mol. Its IUPAC name is N'-[4-(1,5-dimethylpyrazol-4-yl)phenyl]-1-formyl-4-(methylamino)-3,6-dihydro-2H-pyridine-5-carboximidamide.
| Compound Name | N'-[4-(1,5-dimethylpyrazol-4-yl)phenyl]-1-formyl-4-(methylamino)-3,6-dihydro-2H-pyridine-5-carboximidamide |
|---|---|
| PubChem CID | 139398826 |
| Molecular Formula | C19H24N6O |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | N'-[4-(1,5-dimethylpyrazol-4-yl)phenyl]-1-formyl-4-(methylamino)-3,6-dihydro-2H-pyridine-5-carboximidamide |
| SMILES | CNC1=C(/C(N)=N/c2ccc(-c3cnn(C)c3C)cc2)CN(C=O)CC1 |
| InChI | InChI=1S/C19H24N6O/c1-13-16(10-22-24(13)3)14-4-6-15(7-5-14)23-19(20)17-11-25(12-26)9-8-18(17)21-2/h4-7,10,12,21H,8-9,11H2,1-3H3,(H2,20,23) |
| InChIKey | FKGOQOCODPZTBW-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|