C15H26N2 — CID 139398983
1-hexan-3-yl-4-methyl-2,3,4a,8a-tetrahydroquinoxaline (PubChem CID 139398983) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 1-hexan-3-yl-4-methyl-2,3,4a,8a-tetrahydroquinoxaline.
| Compound Name | 1-hexan-3-yl-4-methyl-2,3,4a,8a-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 139398983 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 1-hexan-3-yl-4-methyl-2,3,4a,8a-tetrahydroquinoxaline |
| SMILES | CCCC(CC)N1CCN(C)C2C=CC=CC21 |
| InChI | InChI=1S/C15H26N2/c1-4-8-13(5-2)17-12-11-16(3)14-9-6-7-10-15(14)17/h6-7,9-10,13-15H,4-5,8,11-12H2,1-3H3 |
| InChIKey | MBIRRQOCQCWQNQ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |