C22H33N5O — CID 139399044
1-acetyl-N'-(3-methylphenyl)-4-[(1-methylpiperidin-3-yl)methylamino]-3,6-dihydro-2H-pyridine-5-carboximidamide (PubChem CID 139399044) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is 1-acetyl-N'-(3-methylphenyl)-4-[(1-methylpiperidin-3-yl)methylamino]-3,6-dihydro-2H-pyridine-5-carboximidamide.
| Compound Name | 1-acetyl-N'-(3-methylphenyl)-4-[(1-methylpiperidin-3-yl)methylamino]-3,6-dihydro-2H-pyridine-5-carboximidamide |
|---|---|
| PubChem CID | 139399044 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | 1-acetyl-N'-(3-methylphenyl)-4-[(1-methylpiperidin-3-yl)methylamino]-3,6-dihydro-2H-pyridine-5-carboximidamide |
| SMILES | CC(=O)N1CCC(NCC2CCCN(C)C2)=C(/C(N)=N/c2cccc(C)c2)C1 |
| InChI | InChI=1S/C22H33N5O/c1-16-6-4-8-19(12-16)25-22(23)20-15-27(17(2)28)11-9-21(20)24-13-18-7-5-10-26(3)14-18/h4,6,8,12,18,24H,5,7,9-11,13-15H2,1-3H3,(H2,23,25) |
| InChIKey | XOCBCSJUQDKRQZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 73.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|