C23H30N4 — CID 139399172
1-(cyclopropylmethyl)-5-prop-1-en-2-yl-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine (PubChem CID 139399172) has the molecular formula C23H30N4 and a molecular weight of 362.52 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-5-prop-1-en-2-yl-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine.
| Compound Name | 1-(cyclopropylmethyl)-5-prop-1-en-2-yl-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 139399172 |
| Molecular Formula | C23H30N4 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 1-(cyclopropylmethyl)-5-prop-1-en-2-yl-N-(5,6,7,8-tetrahydronaphthalen-2-yl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridin-3-amine |
| SMILES | C=C(C)N1CCc2c(c(Nc3ccc4c(c3)CCCC4)nn2CC2CC2)C1 |
| InChI | InChI=1S/C23H30N4/c1-16(2)26-12-11-22-21(15-26)23(25-27(22)14-17-7-8-17)24-20-10-9-18-5-3-4-6-19(18)13-20/h9-10,13,17H,1,3-8,11-12,14-15H2,2H3,(H,24,25) |
| InChIKey | VKELMEPHANUYAN-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |