C14H14F3N3O2 — CID 139399252
N-methoxy-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 139399252) has the molecular formula C14H14F3N3O2 and a molecular weight of 313.28 g/mol. Its IUPAC name is N-methoxy-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N-methoxy-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 139399252 |
| Molecular Formula | C14H14F3N3O2 |
| Molecular Weight | 313.28 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | N-methoxy-6-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CONC1CCCc2cc(-c3noc(C(F)(F)F)n3)ccc21 |
| InChI | InChI=1S/C14H14F3N3O2/c1-21-19-11-4-2-3-8-7-9(5-6-10(8)11)12-18-13(22-20-12)14(15,16)17/h5-7,11,19H,2-4H2,1H3 |
| InChIKey | VCNIDISNLZWNIR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.28 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|