C18H29NO3 — CID 139399341
N-[(3E,5Z)-6-cyclopentyloxy-5-methoxy-3-methylocta-3,5,7-trienyl]-N-ethylformamide (PubChem CID 139399341) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is N-[(3E,5Z)-6-cyclopentyloxy-5-methoxy-3-methylocta-3,5,7-trienyl]-N-ethylformamide.
| Compound Name | N-[(3E,5Z)-6-cyclopentyloxy-5-methoxy-3-methylocta-3,5,7-trienyl]-N-ethylformamide |
|---|---|
| PubChem CID | 139399341 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | N-[(3E,5Z)-6-cyclopentyloxy-5-methoxy-3-methylocta-3,5,7-trienyl]-N-ethylformamide |
| SMILES | C=C/C(OC1CCCC1)=C(\C=C(/C)CCN(C=O)CC)OC |
| InChI | InChI=1S/C18H29NO3/c1-5-17(22-16-9-7-8-10-16)18(21-4)13-15(3)11-12-19(6-2)14-20/h5,13-14,16H,1,6-12H2,2-4H3/b15-13+,18-17- |
| InChIKey | VTLVUOXZTVGGLV-CELSGOLJSA-N |
| XLogP | 3.80 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|