C28H34N2O4 — CID 139399427
(1R)-7-ethoxy-6-methoxy-1-[4-(5-methoxy-1H-indol-3-yl)cyclohexyl]-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 139399427) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is (1R)-7-ethoxy-6-methoxy-1-[4-(5-methoxy-1H-indol-3-yl)cyclohexyl]-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | (1R)-7-ethoxy-6-methoxy-1-[4-(5-methoxy-1H-indol-3-yl)cyclohexyl]-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 139399427 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | (1R)-7-ethoxy-6-methoxy-1-[4-(5-methoxy-1H-indol-3-yl)cyclohexyl]-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | CCOc1cc2c(cc1OC)CCN(C=O)[C@@H]2C1CCC(c2c[nH]c3ccc(OC)cc23)CC1 |
| InChI | InChI=1S/C28H34N2O4/c1-4-34-27-15-22-20(13-26(27)33-3)11-12-30(17-31)28(22)19-7-5-18(6-8-19)24-16-29-25-10-9-21(32-2)14-23(24)25/h9-10,13-19,28-29H,4-8,11-12H2,1-3H3/t18?,19?,28-/m1/s1 |
| InChIKey | FPBAZBNCJWWNKB-YNGYXACWSA-N |
| XLogP | 5.61 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|