C19H32N4O4S — CID 139399745
tert-butyl (4S)-2,2-dimethyl-4-[3-[(6-sulfamoyl-2-pyridinyl)amino]propyl]pyrrolidine-1-carboxylate (PubChem CID 139399745) has the molecular formula C19H32N4O4S and a molecular weight of 412.56 g/mol. Its IUPAC name is tert-butyl (4S)-2,2-dimethyl-4-[3-[(6-sulfamoyl-2-pyridinyl)amino]propyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (4S)-2,2-dimethyl-4-[3-[(6-sulfamoyl-2-pyridinyl)amino]propyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139399745 |
| Molecular Formula | C19H32N4O4S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | tert-butyl (4S)-2,2-dimethyl-4-[3-[(6-sulfamoyl-2-pyridinyl)amino]propyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](CCCNc2cccc(S(N)(=O)=O)n2)CC1(C)C |
| InChI | InChI=1S/C19H32N4O4S/c1-18(2,3)27-17(24)23-13-14(12-19(23,4)5)8-7-11-21-15-9-6-10-16(22-15)28(20,25)26/h6,9-10,14H,7-8,11-13H2,1-5H3,(H,21,22)(H2,20,25,26)/t14-/m0/s1 |
| InChIKey | ASBLCXVIWZIOFQ-AWEZNQCLSA-N |
| XLogP | 2.96 |
| TPSA | 114.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|