C18H22ClN5O3S — CID 139400040
4-chloro-20,20-dimethyl-10,10-dioxo-10λ6-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one (PubChem CID 139400040) has the molecular formula C18H22ClN5O3S and a molecular weight of 423.93 g/mol. Its IUPAC name is 4-chloro-20,20-dimethyl-10,10-dioxo-10λ6-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one.
| Compound Name | 4-chloro-20,20-dimethyl-10,10-dioxo-10λ6-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one |
|---|---|
| PubChem CID | 139400040 |
| Molecular Formula | C18H22ClN5O3S |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 4-chloro-20,20-dimethyl-10,10-dioxo-10λ6-thia-1,3,9,14,22-pentazatetracyclo[16.2.1.111,14.02,7]docosa-2(7),3,5,11(22),12-pentaen-8-one |
| SMILES | CC1(C)CC2CCCn3ccc(n3)S(=O)(=O)NC(=O)c3ccc(Cl)nc3N1C2 |
| InChI | InChI=1S/C18H22ClN5O3S/c1-18(2)10-12-4-3-8-23-9-7-15(21-23)28(26,27)22-17(25)13-5-6-14(19)20-16(13)24(18)11-12/h5-7,9,12H,3-4,8,10-11H2,1-2H3,(H,22,25) |
| InChIKey | QCSVPIJXTLYRFS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|