C32H30ClF2N5O3 — CID 139400693
4-chloro-2-[2,6-difluoro-3-[(2-propan-2-yl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl)amino]phenyl]-6-[(2,4-dimethoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one (PubChem CID 139400693) has the molecular formula C32H30ClF2N5O3 and a molecular weight of 606.07 g/mol. Its IUPAC name is 4-chloro-2-[2,6-difluoro-3-[(2-propan-2-yl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl)amino]phenyl]-6-[(2,4-dimethoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one.
| Compound Name | 4-chloro-2-[2,6-difluoro-3-[(2-propan-2-yl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl)amino]phenyl]-6-[(2,4-dimethoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 139400693 |
| Molecular Formula | C32H30ClF2N5O3 |
| Molecular Weight | 606.07 g/mol |
| Exact Mass | 605.20 |
| IUPAC Name | 4-chloro-2-[2,6-difluoro-3-[(2-propan-2-yl-1,3-dihydropyrrolo[3,4-c]pyridin-6-yl)amino]phenyl]-6-[(2,4-dimethoxyphenyl)methyl]-7H-pyrrolo[3,4-b]pyridin-5-one |
| SMILES | COc1ccc(CN2Cc3nc(-c4c(F)ccc(Nc5cc6c(cn5)CN(C(C)C)C6)c4F)cc(Cl)c3C2=O)c(OC)c1 |
| InChI | InChI=1S/C32H30ClF2N5O3/c1-17(2)39-14-19-9-28(36-12-20(19)15-39)38-24-8-7-23(34)30(31(24)35)25-11-22(33)29-26(37-25)16-40(32(29)41)13-18-5-6-21(42-3)10-27(18)43-4/h5-12,17H,13-16H2,1-4H3,(H,36,38) |
| InChIKey | BXZUDERVARCOOJ-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.07 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |