C31H48O3S — CID 139400998
(2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2S)-1-(benzenesulfonyl)propan-2-yl]cyclopentyl]-5-butyl-2-ethyl-4a-methyl-1,3,4,5,6,7-hexahydronaphthalen-2-ol (PubChem CID 139400998) has the molecular formula C31H48O3S and a molecular weight of 500.79 g/mol. Its IUPAC name is (2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2S)-1-(benzenesulfonyl)propan-2-yl]cyclopentyl]-5-butyl-2-ethyl-4a-methyl-1,3,4,5,6,7-hexahydronaphthalen-2-ol.
| Compound Name | (2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2S)-1-(benzenesulfonyl)propan-2-yl]cyclopentyl]-5-butyl-2-ethyl-4a-methyl-1,3,4,5,6,7-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 139400998 |
| Molecular Formula | C31H48O3S |
| Molecular Weight | 500.79 g/mol |
| Exact Mass | 500.33 |
| IUPAC Name | (2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2S)-1-(benzenesulfonyl)propan-2-yl]cyclopentyl]-5-butyl-2-ethyl-4a-methyl-1,3,4,5,6,7-hexahydronaphthalen-2-ol |
| SMILES | CCCC[C@H]1[C@H]([C@@H]2CC[C@H]([C@H](C)CS(=O)(=O)c3ccccc3)C2)CC=C2C[C@](O)(CC)CC[C@@]21C |
| InChI | InChI=1S/C31H48O3S/c1-5-7-13-29-28(17-16-26-21-31(32,6-2)19-18-30(26,29)4)25-15-14-24(20-25)23(3)22-35(33,34)27-11-9-8-10-12-27/h8-12,16,23-25,28-29,32H,5-7,13-15,17-22H2,1-4H3/t23-,24+,25-,28+,29+,30+,31+/m1/s1 |
| InChIKey | DYZICXDZZBZZNU-ZWOYZMRBSA-N |
| XLogP | 7.60 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.79 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|