C34H51F3O4S — CID 139401249
(2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2R,6S)-4-(benzenesulfonyl)-7,7,7-trifluoro-6-hydroxyheptan-2-yl]cyclopentyl]-5-butyl-2-ethyl-3,4,4a,5,6,7-hexahydro-1H-naphthalen-2-ol (PubChem CID 139401249) has the molecular formula C34H51F3O4S and a molecular weight of 612.84 g/mol. Its IUPAC name is (2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2R,6S)-4-(benzenesulfonyl)-7,7,7-trifluoro-6-hydroxyheptan-2-yl]cyclopentyl]-5-butyl-2-ethyl-3,4,4a,5,6,7-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2R,6S)-4-(benzenesulfonyl)-7,7,7-trifluoro-6-hydroxyheptan-2-yl]cyclopentyl]-5-butyl-2-ethyl-3,4,4a,5,6,7-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 139401249 |
| Molecular Formula | C34H51F3O4S |
| Molecular Weight | 612.84 g/mol |
| Exact Mass | 612.35 |
| IUPAC Name | (2S,4aR,5S,6S)-6-[(1R,3S)-3-[(2R,6S)-4-(benzenesulfonyl)-7,7,7-trifluoro-6-hydroxyheptan-2-yl]cyclopentyl]-5-butyl-2-ethyl-3,4,4a,5,6,7-hexahydro-1H-naphthalen-2-ol |
| SMILES | CCCC[C@H]1[C@H]([C@@H]2CC[C@H]([C@H](C)CC(C[C@H](O)C(F)(F)F)S(=O)(=O)c3ccccc3)C2)CC=C2C[C@](O)(CC)CC[C@@H]21 |
| InChI | InChI=1S/C34H51F3O4S/c1-4-6-12-31-29(16-15-26-22-33(39,5-2)18-17-30(26)31)25-14-13-24(20-25)23(3)19-28(21-32(38)34(35,36)37)42(40,41)27-10-8-7-9-11-27/h7-11,15,23-25,28-32,38-39H,4-6,12-14,16-22H2,1-3H3/t23-,24+,25-,28?,29+,30+,31+,32+,33+/m1/s1 |
| InChIKey | QLZANHMYSBRPRS-DXNRCYEJSA-N |
| XLogP | 8.28 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.84 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|