C22H28N2O5S — CID 139401484
N-[2-[(1-hydroxy-1-methoxy-5-methylhexan-2-yl)amino]-2-oxoethyl]-4H-thieno[3,2-c]chromene-2-carboxamide (PubChem CID 139401484) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is N-[2-[(1-hydroxy-1-methoxy-5-methylhexan-2-yl)amino]-2-oxoethyl]-4H-thieno[3,2-c]chromene-2-carboxamide.
| Compound Name | N-[2-[(1-hydroxy-1-methoxy-5-methylhexan-2-yl)amino]-2-oxoethyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
|---|---|
| PubChem CID | 139401484 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N-[2-[(1-hydroxy-1-methoxy-5-methylhexan-2-yl)amino]-2-oxoethyl]-4H-thieno[3,2-c]chromene-2-carboxamide |
| SMILES | COC(O)C(CCC(C)C)NC(=O)CNC(=O)c1cc2c(s1)-c1ccccc1OC2 |
| InChI | InChI=1S/C22H28N2O5S/c1-13(2)8-9-16(22(27)28-3)24-19(25)11-23-21(26)18-10-14-12-29-17-7-5-4-6-15(17)20(14)30-18/h4-7,10,13,16,22,27H,8-9,11-12H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | UOUPMOSNYOXOQD-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|