About 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene
1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene (PubChem CID 139403044) has the molecular formula C13H17NO
and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene.
Molecular Properties
| Compound Name | 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene |
| PubChem CID | 139403044 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene |
| SMILES | CC[C@@H](N=C=O)c1ccc(C)c(C)c1C |
| InChI | InChI=1S/C13H17NO/c1-5-13(14-8-15)12-7-6-9(2)10(3)11(12)4/h6-7,13H,5H2,1-4H3/t13-/m1/s1 |
| InChIKey | VXHXVVMZPODJQK-CYBMUJFWSA-N |
| XLogP | 3.40 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene?
The IUPAC name of 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene (CID 139403044) is 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene.
What is the SMILES notation for 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene?
The canonical SMILES for 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene is CC[C@@H](N=C=O)c1ccc(C)c(C)c1C.
What is the InChIKey of 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene?
The InChIKey is VXHXVVMZPODJQK-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H17NO/c1-5-13(14-8-15)12-7-6-9(2)10(3)11(12)4/h6-7,13H,5H2,1-4H3/t13-/m1/s1.
What are the key properties of 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene?
1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene has a molecular weight of 203.28 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R)-1-isocyanatopropyl]-2,3,4-trimethylbenzene is sourced from PubChem (CID 139403044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).