About 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane
6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane (PubChem CID 139403585) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane |
| PubChem CID | 139403585 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane |
| SMILES | CC1C2CNCC(C2)N1C |
| InChI | InChI=1S/C8H16N2/c1-6-7-3-8(10(6)2)5-9-4-7/h6-9H,3-5H2,1-2H3 |
| InChIKey | FVMQXTOUYPBZAI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane?
The IUPAC name of 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane (CID 139403585) is 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane.
What is the SMILES notation for 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane?
The canonical SMILES for 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane is CC1C2CNCC(C2)N1C.
What is the InChIKey of 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane?
The InChIKey is FVMQXTOUYPBZAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2/c1-6-7-3-8(10(6)2)5-9-4-7/h6-9H,3-5H2,1-2H3.
What are the key properties of 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane?
6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane has a molecular weight of 140.23 g/mol, XLogP of 0.30, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-3,6-diazabicyclo[3.2.1]octane is sourced from PubChem (CID 139403585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).