About 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene
1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene (PubChem CID 139403704) has the molecular formula C12H11F3
and a molecular weight of 212.21 g/mol. Its IUPAC name is 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene.
Molecular Properties
| Compound Name | 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene |
| PubChem CID | 139403704 |
| Molecular Formula | C12H11F3 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene |
| SMILES | C=Cc1c(F)c(F)c(C)c(F)c1/C=C/C |
| InChI | InChI=1S/C12H11F3/c1-4-6-9-8(5-2)12(15)11(14)7(3)10(9)13/h4-6H,2H2,1,3H3/b6-4+ |
| InChIKey | SHMVUIWJCHNEMX-GQCTYLIASA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene?
The IUPAC name of 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene (CID 139403704) is 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene.
What is the SMILES notation for 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene?
The canonical SMILES for 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene is C=Cc1c(F)c(F)c(C)c(F)c1/C=C/C.
What is the InChIKey of 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene?
The InChIKey is SHMVUIWJCHNEMX-GQCTYLIASA-N. The full InChI is InChI=1S/C12H11F3/c1-4-6-9-8(5-2)12(15)11(14)7(3)10(9)13/h4-6H,2H2,1,3H3/b6-4+.
What are the key properties of 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene?
1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene has a molecular weight of 212.21 g/mol, XLogP of 4.09, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2,3,5-trifluoro-4-methyl-6-[(E)-prop-1-enyl]benzene is sourced from PubChem (CID 139403704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).