About N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine
N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine (PubChem CID 139403765) has the molecular formula C22H41N
and a molecular weight of 319.58 g/mol. Its IUPAC name is N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine.
Molecular Properties
| Compound Name | N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine |
| PubChem CID | 139403765 |
| Molecular Formula | C22H41N |
| Molecular Weight | 319.58 g/mol |
| Exact Mass | 319.32 |
| IUPAC Name | N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine |
| SMILES | CCCC(CCCN=C(C)C)CCC(C)C1(C)CCC=C(C)C1 |
| InChI | InChI=1S/C22H41N/c1-7-10-21(12-9-16-23-18(2)3)14-13-20(5)22(6)15-8-11-19(4)17-22/h11,20-21H,7-10,12-17H2,1-6H3 |
| InChIKey | WVISSYQTEHGSKW-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.58 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine?
The IUPAC name of N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine (CID 139403765) is N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine.
What is the SMILES notation for N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine?
The canonical SMILES for N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine is CCCC(CCCN=C(C)C)CCC(C)C1(C)CCC=C(C)C1.
What is the InChIKey of N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine?
The InChIKey is WVISSYQTEHGSKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H41N/c1-7-10-21(12-9-16-23-18(2)3)14-13-20(5)22(6)15-8-11-19(4)17-22/h11,20-21H,7-10,12-17H2,1-6H3.
What are the key properties of N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine?
N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine has a molecular weight of 319.58 g/mol, XLogP of 7.22, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-(1,3-dimethylcyclohex-3-en-1-yl)-4-propyloctyl]propan-2-imine is sourced from PubChem (CID 139403765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).