About 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one
4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one (PubChem CID 139404181) has the molecular formula C24H15NO4S
and a molecular weight of 413.45 g/mol. Its IUPAC name is 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one |
| PubChem CID | 139404181 |
| Molecular Formula | C24H15NO4S |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one |
| SMILES | O=C(c1ccccc1)c1sc2cc(O)ccc2c1-c1ccc(-c2co[nH]c2=O)cc1 |
| InChI | InChI=1S/C24H15NO4S/c26-17-10-11-18-20(12-17)30-23(22(27)16-4-2-1-3-5-16)21(18)15-8-6-14(7-9-15)19-13-29-25-24(19)28/h1-13,26H,(H,25,28) |
| InChIKey | CEVRPAPTILHNCX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one?
The IUPAC name of 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one (CID 139404181) is 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one.
What is the SMILES notation for 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one?
The canonical SMILES for 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one is O=C(c1ccccc1)c1sc2cc(O)ccc2c1-c1ccc(-c2co[nH]c2=O)cc1.
What is the InChIKey of 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one?
The InChIKey is CEVRPAPTILHNCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H15NO4S/c26-17-10-11-18-20(12-17)30-23(22(27)16-4-2-1-3-5-16)21(18)15-8-6-14(7-9-15)19-13-29-25-24(19)28/h1-13,26H,(H,25,28).
What are the key properties of 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one?
4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one has a molecular weight of 413.45 g/mol, XLogP of 5.45, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-(2-benzoyl-6-hydroxy-1-benzothiophen-3-yl)phenyl]-1,2-oxazol-3-one is sourced from PubChem (CID 139404181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).