About 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one
4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one (PubChem CID 139404509) has the molecular formula C11H8N2OS
and a molecular weight of 216.27 g/mol. Its IUPAC name is 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one.
Molecular Properties
| Compound Name | 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one |
| PubChem CID | 139404509 |
| Molecular Formula | C11H8N2OS |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one |
| SMILES | O=C1NC(c2cccnc2)c2ccsc21 |
| InChI | InChI=1S/C11H8N2OS/c14-11-10-8(3-5-15-10)9(13-11)7-2-1-4-12-6-7/h1-6,9H,(H,13,14) |
| InChIKey | UFXBIZFYZCHQGH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one?
The IUPAC name of 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one (CID 139404509) is 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one.
What is the SMILES notation for 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one?
The canonical SMILES for 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one is O=C1NC(c2cccnc2)c2ccsc21.
What is the InChIKey of 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one?
The InChIKey is UFXBIZFYZCHQGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2OS/c14-11-10-8(3-5-15-10)9(13-11)7-2-1-4-12-6-7/h1-6,9H,(H,13,14).
What are the key properties of 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one?
4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one has a molecular weight of 216.27 g/mol, XLogP of 1.98, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-3-yl-4,5-dihydrothieno[2,3-c]pyrrol-6-one is sourced from PubChem (CID 139404509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).