C14H20N2 — CID 139404819
(1Z,4Z)-1,4-di(ethylidene)-5,6,7,8,9,10-hexahydrocycloocta[d]pyridazine (PubChem CID 139404819) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (1Z,4Z)-1,4-di(ethylidene)-5,6,7,8,9,10-hexahydrocycloocta[d]pyridazine.
| Compound Name | (1Z,4Z)-1,4-di(ethylidene)-5,6,7,8,9,10-hexahydrocycloocta[d]pyridazine |
|---|---|
| PubChem CID | 139404819 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (1Z,4Z)-1,4-di(ethylidene)-5,6,7,8,9,10-hexahydrocycloocta[d]pyridazine |
| SMILES | C/C=c1\nn/c(=C\C)c2c1CCCCCC2 |
| InChI | InChI=1S/C14H20N2/c1-3-13-11-9-7-5-6-8-10-12(11)14(4-2)16-15-13/h3-4H,5-10H2,1-2H3/b13-3-,14-4- |
| InChIKey | YRKOOCNTHLTOSK-JJNPTMGBSA-N |
| XLogP | 1.74 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |