C14H24N2O2 — CID 139404880
1-[4-(1-hydroxyethyl)-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-1-yl]ethanol (PubChem CID 139404880) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 1-[4-(1-hydroxyethyl)-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-1-yl]ethanol.
| Compound Name | 1-[4-(1-hydroxyethyl)-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-1-yl]ethanol |
|---|---|
| PubChem CID | 139404880 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 1-[4-(1-hydroxyethyl)-3,5,6,7,8,9,10,10a-octahydrocycloocta[d]pyridazin-1-yl]ethanol |
| SMILES | CC(O)C1=NNC(C(C)O)=C2CCCCCCC12 |
| InChI | InChI=1S/C14H24N2O2/c1-9(17)13-11-7-5-3-4-6-8-12(11)14(10(2)18)16-15-13/h9-11,16-18H,3-8H2,1-2H3 |
| InChIKey | DHEQPBYRFMVJAM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |