C19H30O4 — CID 139404902
(5Z)-5-[[(6E)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]methyl]cyclooct-5-ene-1,2-diol (PubChem CID 139404902) has the molecular formula C19H30O4 and a molecular weight of 322.44 g/mol. Its IUPAC name is (5Z)-5-[[(6E)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]methyl]cyclooct-5-ene-1,2-diol.
| Compound Name | (5Z)-5-[[(6E)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]methyl]cyclooct-5-ene-1,2-diol |
|---|---|
| PubChem CID | 139404902 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (5Z)-5-[[(6E)-2-methyl-3a,4,5,8,9,9a-hexahydrocycloocta[d][1,3]dioxol-2-yl]methyl]cyclooct-5-ene-1,2-diol |
| SMILES | CC1(C/C2=C/CCC(O)C(O)CC2)OC2CC/C=C\CCC2O1 |
| InChI | InChI=1S/C19H30O4/c1-19(13-14-7-6-8-15(20)16(21)12-11-14)22-17-9-4-2-3-5-10-18(17)23-19/h2-3,7,15-18,20-21H,4-6,8-13H2,1H3/b3-2-,14-7+ |
| InChIKey | MKXBEFMXIPXBFJ-HQHDCNBVSA-N |
| XLogP | 3.23 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|