C14H13N3O2 — CID 139404981
7-tert-butyl-2,7,12-triazatricyclo[7.3.1.05,13]trideca-1,3,5(13),9,11-pentaene-6,8-dione (PubChem CID 139404981) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 7-tert-butyl-2,7,12-triazatricyclo[7.3.1.05,13]trideca-1,3,5(13),9,11-pentaene-6,8-dione.
| Compound Name | 7-tert-butyl-2,7,12-triazatricyclo[7.3.1.05,13]trideca-1,3,5(13),9,11-pentaene-6,8-dione |
|---|---|
| PubChem CID | 139404981 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 7-tert-butyl-2,7,12-triazatricyclo[7.3.1.05,13]trideca-1,3,5(13),9,11-pentaene-6,8-dione |
| SMILES | CC(C)(C)N1C(=O)c2ccnc3nccc(c23)C1=O |
| InChI | InChI=1S/C14H13N3O2/c1-14(2,3)17-12(18)8-4-6-15-11-10(8)9(13(17)19)5-7-16-11/h4-7H,1-3H3 |
| InChIKey | PXUNOBYGCUZSEX-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|