C26H38F6O3 — CID 139405097
[9-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 139405097) has the molecular formula C26H38F6O3 and a molecular weight of 512.58 g/mol. Its IUPAC name is [9-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | [9-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 139405097 |
| Molecular Formula | C26H38F6O3 |
| Molecular Weight | 512.58 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | [9-[3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propyl]-4-tetracyclo[6.2.1.13,6.02,7]dodecanyl] 4,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)C(CC(C)(C)C)C(=O)OC1CC2CC1C1C3CC(CC(O)(C(F)(F)F)C(F)(F)F)C(C3)C21 |
| InChI | InChI=1S/C26H38F6O3/c1-12(2)18(11-23(3,4)5)22(33)35-19-9-14-8-17(19)21-13-6-15(16(7-13)20(14)21)10-24(34,25(27,28)29)26(30,31)32/h12-21,34H,6-11H2,1-5H3 |
| InChIKey | WBVUYBTVMPTEKK-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.58 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|