C16H24Cl2N4O2 — CID 139405120
2-chloro-N-[5-chloro-2-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl-methylamino]-4-pyridinyl]acetamide (PubChem CID 139405120) has the molecular formula C16H24Cl2N4O2 and a molecular weight of 375.30 g/mol. Its IUPAC name is 2-chloro-N-[5-chloro-2-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl-methylamino]-4-pyridinyl]acetamide.
| Compound Name | 2-chloro-N-[5-chloro-2-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl-methylamino]-4-pyridinyl]acetamide |
|---|---|
| PubChem CID | 139405120 |
| Molecular Formula | C16H24Cl2N4O2 |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-chloro-N-[5-chloro-2-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl-methylamino]-4-pyridinyl]acetamide |
| SMILES | C[C@@H]1CN(CCN(C)c2cc(NC(=O)CCl)c(Cl)cn2)C[C@H](C)O1 |
| InChI | InChI=1S/C16H24Cl2N4O2/c1-11-9-22(10-12(2)24-11)5-4-21(3)15-6-14(13(18)8-19-15)20-16(23)7-17/h6,8,11-12H,4-5,7,9-10H2,1-3H3,(H,19,20,23)/t11-,12+ |
| InChIKey | MVCIBIHFXAZJPG-TXEJJXNPSA-N |
| XLogP | 2.46 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|