C13H21ClN4 — CID 139405515
5-chloro-2-(3,3,5,5-tetramethylpiperazin-1-yl)pyridin-4-amine (PubChem CID 139405515) has the molecular formula C13H21ClN4 and a molecular weight of 268.79 g/mol. Its IUPAC name is 5-chloro-2-(3,3,5,5-tetramethylpiperazin-1-yl)pyridin-4-amine.
| Compound Name | 5-chloro-2-(3,3,5,5-tetramethylpiperazin-1-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 139405515 |
| Molecular Formula | C13H21ClN4 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 5-chloro-2-(3,3,5,5-tetramethylpiperazin-1-yl)pyridin-4-amine |
| SMILES | CC1(C)CN(c2cc(N)c(Cl)cn2)CC(C)(C)N1 |
| InChI | InChI=1S/C13H21ClN4/c1-12(2)7-18(8-13(3,4)17-12)11-5-10(15)9(14)6-16-11/h5-6,17H,7-8H2,1-4H3,(H2,15,16) |
| InChIKey | UQSLYYZYQHFXMU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |