C31H31FN4O6 — CID 139405669
1-(4-fluorophenyl)-3-[4-[[5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea (PubChem CID 139405669) has the molecular formula C31H31FN4O6 and a molecular weight of 574.61 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[4-[[5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[4-[[5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea |
|---|---|
| PubChem CID | 139405669 |
| Molecular Formula | C31H31FN4O6 |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[4-[[5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea |
| SMILES | O=C(Nc1ccc(F)cc1)Nc1ccc(Oc2ccnc3cc(OCCCN4CCOCC4)c4c(c23)OCCO4)cc1 |
| InChI | InChI=1S/C31H31FN4O6/c32-21-2-4-22(5-3-21)34-31(37)35-23-6-8-24(9-7-23)42-26-10-11-33-25-20-27(29-30(28(25)26)41-19-18-40-29)39-15-1-12-36-13-16-38-17-14-36/h2-11,20H,1,12-19H2,(H2,34,35,37) |
| InChIKey | VPPMPMTVPFDAMJ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|