C31H30F2N4O6 — CID 139405670
1-(2,4-difluorophenyl)-3-[4-[[5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea (PubChem CID 139405670) has the molecular formula C31H30F2N4O6 and a molecular weight of 592.60 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[4-[[5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[4-[[5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea |
|---|---|
| PubChem CID | 139405670 |
| Molecular Formula | C31H30F2N4O6 |
| Molecular Weight | 592.60 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[4-[[5-(3-morpholin-4-ylpropoxy)-2,3-dihydro-[1,4]dioxino[2,3-f]quinolin-10-yl]oxy]phenyl]urea |
| SMILES | O=C(Nc1ccc(Oc2ccnc3cc(OCCCN4CCOCC4)c4c(c23)OCCO4)cc1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C31H30F2N4O6/c32-20-2-7-24(23(33)18-20)36-31(38)35-21-3-5-22(6-4-21)43-26-8-9-34-25-19-27(29-30(28(25)26)42-17-16-41-29)40-13-1-10-37-11-14-39-15-12-37/h2-9,18-19H,1,10-17H2,(H2,35,36,38) |
| InChIKey | PYIDXIFWUPFNTC-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.60 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|