C11H17N — CID 139406469
(2Z,4S,5Z)-4-methyl-N-prop-2-enylhepta-2,5-dien-1-imine (PubChem CID 139406469) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is (2Z,4S,5Z)-4-methyl-N-prop-2-enylhepta-2,5-dien-1-imine.
| Compound Name | (2Z,4S,5Z)-4-methyl-N-prop-2-enylhepta-2,5-dien-1-imine |
|---|---|
| PubChem CID | 139406469 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | (2Z,4S,5Z)-4-methyl-N-prop-2-enylhepta-2,5-dien-1-imine |
| SMILES | C=CC/N=C/C=C\[C@@H](C)/C=C\C |
| InChI | InChI=1S/C11H17N/c1-4-7-11(3)8-6-10-12-9-5-2/h4-8,10-11H,2,9H2,1,3H3/b7-4-,8-6-,12-10+/t11-/m0/s1 |
| InChIKey | RFZLWIFKDWKSSW-ZWDDSPMGSA-N |
| XLogP | 3.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|