C28H39N7O2 — CID 139406575
1-[4-[(6R,7R)-7-(3-amino-2-methanimidoyl-6-methylphenyl)-2-[2-(dimethylamino)ethoxy]-6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 139406575) has the molecular formula C28H39N7O2 and a molecular weight of 505.67 g/mol. Its IUPAC name is 1-[4-[(6R,7R)-7-(3-amino-2-methanimidoyl-6-methylphenyl)-2-[2-(dimethylamino)ethoxy]-6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[(6R,7R)-7-(3-amino-2-methanimidoyl-6-methylphenyl)-2-[2-(dimethylamino)ethoxy]-6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139406575 |
| Molecular Formula | C28H39N7O2 |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.32 |
| IUPAC Name | 1-[4-[(6R,7R)-7-(3-amino-2-methanimidoyl-6-methylphenyl)-2-[2-(dimethylamino)ethoxy]-6-methyl-5,6,7,8-tetrahydroquinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | [H]/N=C/c1c(N)ccc(C)c1[C@@H]1Cc2nc(OCCN(C)C)nc(N3CCN(C(=O)C=C)CC3)c2C[C@H]1C |
| InChI | InChI=1S/C28H39N7O2/c1-6-25(36)34-9-11-35(12-10-34)27-21-15-19(3)20(26-18(2)7-8-23(30)22(26)17-29)16-24(21)31-28(32-27)37-14-13-33(4)5/h6-8,17,19-20,29H,1,9-16,30H2,2-5H3/b29-17+/t19-,20-/m1/s1 |
| InChIKey | CTVPCNOAKSADIE-SMVWDTCGSA-N |
| XLogP | 2.66 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|