C16H29N3O3 — CID 139407155
5-azido-3,3,5-trimethyl-1-(2,2,5-trimethyl-1,3-dioxan-5-yl)hexan-1-one (PubChem CID 139407155) has the molecular formula C16H29N3O3 and a molecular weight of 311.43 g/mol. Its IUPAC name is 5-azido-3,3,5-trimethyl-1-(2,2,5-trimethyl-1,3-dioxan-5-yl)hexan-1-one.
| Compound Name | 5-azido-3,3,5-trimethyl-1-(2,2,5-trimethyl-1,3-dioxan-5-yl)hexan-1-one |
|---|---|
| PubChem CID | 139407155 |
| Molecular Formula | C16H29N3O3 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | 5-azido-3,3,5-trimethyl-1-(2,2,5-trimethyl-1,3-dioxan-5-yl)hexan-1-one |
| SMILES | CC(C)(CC(=O)C1(C)COC(C)(C)OC1)CC(C)(C)N=[N+]=[N-] |
| InChI | InChI=1S/C16H29N3O3/c1-13(2,9-14(3,4)18-19-17)8-12(20)16(7)10-21-15(5,6)22-11-16/h8-11H2,1-7H3 |
| InChIKey | VKVMYSDVBRZTAU-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|