C16H24N2 — CID 139408858
(3R)-4-(7-tert-butyl-3-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-3-methylbutanimidamide (PubChem CID 139408858) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is (3R)-4-(7-tert-butyl-3-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-3-methylbutanimidamide.
| Compound Name | (3R)-4-(7-tert-butyl-3-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-3-methylbutanimidamide |
|---|---|
| PubChem CID | 139408858 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | (3R)-4-(7-tert-butyl-3-bicyclo[4.1.0]hepta-1(7),2,4-trienyl)-3-methylbutanimidamide |
| SMILES | [H]/N=C(\N)C[C@H](C)CC1=CC2=C(C(C)(C)C)C2C=C1 |
| InChI | InChI=1S/C16H24N2/c1-10(8-14(17)18)7-11-5-6-12-13(9-11)15(12)16(2,3)4/h5-6,9-10,12H,7-8H2,1-4H3,(H3,17,18)/t10-,12?/m1/s1 |
| InChIKey | KZZKKOGHXWZONK-RWANSRKNSA-N |
| XLogP | 3.81 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|