C15H11F3N2O2S — CID 139409215
N-sulfanyl-4-[(5S)-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-3-yl]naphthalene-1-carboxamide (PubChem CID 139409215) has the molecular formula C15H11F3N2O2S and a molecular weight of 340.33 g/mol. Its IUPAC name is N-sulfanyl-4-[(5S)-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-3-yl]naphthalene-1-carboxamide.
| Compound Name | N-sulfanyl-4-[(5S)-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 139409215 |
| Molecular Formula | C15H11F3N2O2S |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | N-sulfanyl-4-[(5S)-5-(trifluoromethyl)-4,5-dihydro-1,2-oxazol-3-yl]naphthalene-1-carboxamide |
| SMILES | O=C(NS)c1ccc(C2=NO[C@H](C(F)(F)F)C2)c2ccccc12 |
| InChI | InChI=1S/C15H11F3N2O2S/c16-15(17,18)13-7-12(19-22-13)10-5-6-11(14(21)20-23)9-4-2-1-3-8(9)10/h1-6,13,23H,7H2,(H,20,21)/t13-/m0/s1 |
| InChIKey | UMSSRNUTIANSIG-ZDUSSCGKSA-N |
| XLogP | 3.47 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|