About 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine
4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine (PubChem CID 139409634) has the molecular formula C14H22FN
and a molecular weight of 223.33 g/mol. Its IUPAC name is 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine |
| PubChem CID | 139409634 |
| Molecular Formula | C14H22FN |
| Molecular Weight | 223.33 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine |
| SMILES | CC(C)C1=C(F)C=C(C2CCNCC2)CC1 |
| InChI | InChI=1S/C14H22FN/c1-10(2)13-4-3-12(9-14(13)15)11-5-7-16-8-6-11/h9-11,16H,3-8H2,1-2H3 |
| InChIKey | BJYIYJJHQUQEEZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine?
The IUPAC name of 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine (CID 139409634) is 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine.
What is the SMILES notation for 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine?
The canonical SMILES for 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine is CC(C)C1=C(F)C=C(C2CCNCC2)CC1.
What is the InChIKey of 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine?
The InChIKey is BJYIYJJHQUQEEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22FN/c1-10(2)13-4-3-12(9-14(13)15)11-5-7-16-8-6-11/h9-11,16H,3-8H2,1-2H3.
What are the key properties of 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine?
4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine has a molecular weight of 223.33 g/mol, XLogP of 3.59, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-fluoro-4-propan-2-ylcyclohexa-1,3-dien-1-yl)piperidine is sourced from PubChem (CID 139409634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).