C25H28FN5O2 — CID 139410088
N-[5-fluoro-4-(8-methoxy-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine (PubChem CID 139410088) has the molecular formula C25H28FN5O2 and a molecular weight of 449.53 g/mol. Its IUPAC name is N-[5-fluoro-4-(8-methoxy-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine.
| Compound Name | N-[5-fluoro-4-(8-methoxy-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
|---|---|
| PubChem CID | 139410088 |
| Molecular Formula | C25H28FN5O2 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | N-[5-fluoro-4-(8-methoxy-4-propan-2-yl-2,3-dihydro-1,4-benzoxazin-6-yl)pyrimidin-2-yl]-1,2,3,4-tetrahydroisoquinolin-6-amine |
| SMILES | COc1cc(-c2nc(Nc3ccc4c(c3)CCNC4)ncc2F)cc2c1OCCN2C(C)C |
| InChI | InChI=1S/C25H28FN5O2/c1-15(2)31-8-9-33-24-21(31)11-18(12-22(24)32-3)23-20(26)14-28-25(30-23)29-19-5-4-17-13-27-7-6-16(17)10-19/h4-5,10-12,14-15,27H,6-9,13H2,1-3H3,(H,28,29,30) |
| InChIKey | VTGWENFUQNXGQT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |