C17H23BrCl2N3O6P — CID 139410564
(1-bromo-1,3-dichloro-2,2-dimethylpropyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione (PubChem CID 139410564) has the molecular formula C17H23BrCl2N3O6P and a molecular weight of 547.17 g/mol. Its IUPAC name is (1-bromo-1,3-dichloro-2,2-dimethylpropyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione.
| Compound Name | (1-bromo-1,3-dichloro-2,2-dimethylpropyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 139410564 |
| Molecular Formula | C17H23BrCl2N3O6P |
| Molecular Weight | 547.17 g/mol |
| Exact Mass | 544.99 |
| IUPAC Name | (1-bromo-1,3-dichloro-2,2-dimethylpropyl) dihydrogen phosphate;2,3,5-tris(aziridin-1-yl)cyclohexa-2,5-diene-1,4-dione |
| SMILES | CC(C)(CCl)C(Cl)(Br)OP(=O)(O)O.O=C1C=C(N2CC2)C(=O)C(N2CC2)=C1N1CC1 |
| InChI | InChI=1S/C12H13N3O2.C5H10BrCl2O4P/c16-9-7-8(13-1-2-13)12(17)11(15-5-6-15)10(9)14-3-4-14;1-4(2,3-7)5(6,8)12-13(9,10)11/h7H,1-6H2;3H2,1-2H3,(H2,9,10,11) |
| InChIKey | HYCLUJAWIHTSCW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.17 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|