About 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane
2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane (PubChem CID 139410923) has the molecular formula C14H24O3S3
and a molecular weight of 336.54 g/mol. Its IUPAC name is 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane.
Molecular Properties
| Compound Name | 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane |
| PubChem CID | 139410923 |
| Molecular Formula | C14H24O3S3 |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane |
| SMILES | C(CSCC1CO1)CC(CSCC1CO1)SCC1CO1 |
| InChI | InChI=1S/C14H24O3S3/c1(3-18-7-11-4-15-11)2-14(20-9-13-6-17-13)10-19-8-12-5-16-12/h11-14H,1-10H2 |
| InChIKey | ZDQFLVNRFLVEFF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 37.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane?
The IUPAC name of 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane (CID 139410923) is 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane.
What is the SMILES notation for 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane?
The canonical SMILES for 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane is C(CSCC1CO1)CC(CSCC1CO1)SCC1CO1.
What is the InChIKey of 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane?
The InChIKey is ZDQFLVNRFLVEFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24O3S3/c1(3-18-7-11-4-15-11)2-14(20-9-13-6-17-13)10-19-8-12-5-16-12/h11-14H,1-10H2.
What are the key properties of 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane?
2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane has a molecular weight of 336.54 g/mol, XLogP of 2.53, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,5-bis(oxiran-2-ylmethylsulfanyl)pentan-2-ylsulfanylmethyl]oxirane is sourced from PubChem (CID 139410923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).