About [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate
[(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate (PubChem CID 139412540) has the molecular formula C9H8F3NO4S
and a molecular weight of 283.23 g/mol. Its IUPAC name is [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate |
| PubChem CID | 139412540 |
| Molecular Formula | C9H8F3NO4S |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate |
| SMILES | N[C@@H]1COc2cc(OS(=O)(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C9H8F3NO4S/c10-9(11,12)18(14,15)17-5-1-2-6-7(13)4-16-8(6)3-5/h1-3,7H,4,13H2/t7-/m1/s1 |
| InChIKey | WODQHRSHXXCQFV-SSDOTTSWSA-N |
| XLogP | 1.31 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate?
The IUPAC name of [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate (CID 139412540) is [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate.
What is the SMILES notation for [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate?
The canonical SMILES for [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate is N[C@@H]1COc2cc(OS(=O)(=O)C(F)(F)F)ccc21.
What is the InChIKey of [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate?
The InChIKey is WODQHRSHXXCQFV-SSDOTTSWSA-N. The full InChI is InChI=1S/C9H8F3NO4S/c10-9(11,12)18(14,15)17-5-1-2-6-7(13)4-16-8(6)3-5/h1-3,7H,4,13H2/t7-/m1/s1.
What are the key properties of [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate?
[(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate has a molecular weight of 283.23 g/mol, XLogP of 1.31, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-3-amino-2,3-dihydro-1-benzofuran-6-yl] trifluoromethanesulfonate is sourced from PubChem (CID 139412540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).