C24H22N2S — CID 139414036
(3S)-5,7-diphenyl-3-propan-2-yl-1,3-dihydro-1,4-benzodiazepine-2-thione (PubChem CID 139414036) has the molecular formula C24H22N2S and a molecular weight of 370.52 g/mol. Its IUPAC name is (3S)-5,7-diphenyl-3-propan-2-yl-1,3-dihydro-1,4-benzodiazepine-2-thione.
| Compound Name | (3S)-5,7-diphenyl-3-propan-2-yl-1,3-dihydro-1,4-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 139414036 |
| Molecular Formula | C24H22N2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | (3S)-5,7-diphenyl-3-propan-2-yl-1,3-dihydro-1,4-benzodiazepine-2-thione |
| SMILES | CC(C)[C@@H]1N=C(c2ccccc2)c2cc(-c3ccccc3)ccc2NC1=S |
| InChI | InChI=1S/C24H22N2S/c1-16(2)22-24(27)25-21-14-13-19(17-9-5-3-6-10-17)15-20(21)23(26-22)18-11-7-4-8-12-18/h3-16,22H,1-2H3,(H,25,27)/t22-/m0/s1 |
| InChIKey | UKFMPJXGBKUAQW-QFIPXVFZSA-N |
| XLogP | 5.97 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|