About (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione
(3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione (PubChem CID 139414110) has the molecular formula C19H17F3N2S
and a molecular weight of 362.42 g/mol. Its IUPAC name is (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione.
Molecular Properties
| Compound Name | (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione |
| PubChem CID | 139414110 |
| Molecular Formula | C19H17F3N2S |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione |
| SMILES | CC(C)[C@@H]1N=C(c2ccccc2)c2cc(C(F)(F)F)ccc2NC1=S |
| InChI | InChI=1S/C19H17F3N2S/c1-11(2)16-18(25)23-15-9-8-13(19(20,21)22)10-14(15)17(24-16)12-6-4-3-5-7-12/h3-11,16H,1-2H3,(H,23,25)/t16-/m0/s1 |
| InChIKey | UXCGQYRRXWYYRY-INIZCTEOSA-N |
| XLogP | 5.32 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione?
The IUPAC name of (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione (CID 139414110) is (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione.
What is the SMILES notation for (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione?
The canonical SMILES for (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione is CC(C)[C@@H]1N=C(c2ccccc2)c2cc(C(F)(F)F)ccc2NC1=S.
What is the InChIKey of (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione?
The InChIKey is UXCGQYRRXWYYRY-INIZCTEOSA-N. The full InChI is InChI=1S/C19H17F3N2S/c1-11(2)16-18(25)23-15-9-8-13(19(20,21)22)10-14(15)17(24-16)12-6-4-3-5-7-12/h3-11,16H,1-2H3,(H,23,25)/t16-/m0/s1.
What are the key properties of (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione?
(3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione has a molecular weight of 362.42 g/mol, XLogP of 5.32, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5-phenyl-3-propan-2-yl-7-(trifluoromethyl)-1,3-dihydro-1,4-benzodiazepine-2-thione is sourced from PubChem (CID 139414110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).