C28H33Cl2N5O4 — CID 139414394
3-(3,5-dichlorophenyl)-3-[[3-[(2-methylpropan-2-yl)oxymethyl]-1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrazole-4-carbonyl]amino]propanoic acid (PubChem CID 139414394) has the molecular formula C28H33Cl2N5O4 and a molecular weight of 574.51 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-[[3-[(2-methylpropan-2-yl)oxymethyl]-1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrazole-4-carbonyl]amino]propanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-3-[[3-[(2-methylpropan-2-yl)oxymethyl]-1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 139414394 |
| Molecular Formula | C28H33Cl2N5O4 |
| Molecular Weight | 574.51 g/mol |
| Exact Mass | 573.19 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-[[3-[(2-methylpropan-2-yl)oxymethyl]-1-[2-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)ethyl]pyrazole-4-carbonyl]amino]propanoic acid |
| SMILES | CC(C)(C)OCc1nn(CCc2ccc3c(n2)NCCC3)cc1C(=O)NC(CC(=O)O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C28H33Cl2N5O4/c1-28(2,3)39-16-24-22(27(38)33-23(14-25(36)37)18-11-19(29)13-20(30)12-18)15-35(34-24)10-8-21-7-6-17-5-4-9-31-26(17)32-21/h6-7,11-13,15,23H,4-5,8-10,14,16H2,1-3H3,(H,31,32)(H,33,38)(H,36,37) |
| InChIKey | AAVQRZZTMSKFIQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.51 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |