C29H35Cl2N5O4 — CID 139414401
3-(3,5-dichlorophenyl)-3-[[5-[(2-methylpropan-2-yl)oxymethyl]-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazole-4-carbonyl]amino]propanoic acid (PubChem CID 139414401) has the molecular formula C29H35Cl2N5O4 and a molecular weight of 588.54 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-3-[[5-[(2-methylpropan-2-yl)oxymethyl]-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazole-4-carbonyl]amino]propanoic acid.
| Compound Name | 3-(3,5-dichlorophenyl)-3-[[5-[(2-methylpropan-2-yl)oxymethyl]-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazole-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 139414401 |
| Molecular Formula | C29H35Cl2N5O4 |
| Molecular Weight | 588.54 g/mol |
| Exact Mass | 587.21 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-3-[[5-[(2-methylpropan-2-yl)oxymethyl]-1-[3-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)propyl]pyrazole-4-carbonyl]amino]propanoic acid |
| SMILES | CC(C)(C)OCc1c(C(=O)NC(CC(=O)O)c2cc(Cl)cc(Cl)c2)cnn1CCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C29H35Cl2N5O4/c1-29(2,3)40-17-25-23(28(39)35-24(15-26(37)38)19-12-20(30)14-21(31)13-19)16-33-36(25)11-5-7-22-9-8-18-6-4-10-32-27(18)34-22/h8-9,12-14,16,24H,4-7,10-11,15,17H2,1-3H3,(H,32,34)(H,35,39)(H,37,38) |
| InChIKey | DCNSMDGELAEQAY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.54 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |