C26H34N4O4 — CID 139414703
6-(2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl)-3-[[4-hydroxy-1-(3-phenylbutanoyl)piperidin-4-yl]methyl]pyrimidin-4-one (PubChem CID 139414703) has the molecular formula C26H34N4O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is 6-(2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl)-3-[[4-hydroxy-1-(3-phenylbutanoyl)piperidin-4-yl]methyl]pyrimidin-4-one.
| Compound Name | 6-(2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl)-3-[[4-hydroxy-1-(3-phenylbutanoyl)piperidin-4-yl]methyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 139414703 |
| Molecular Formula | C26H34N4O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.26 |
| IUPAC Name | 6-(2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-5-yl)-3-[[4-hydroxy-1-(3-phenylbutanoyl)piperidin-4-yl]methyl]pyrimidin-4-one |
| SMILES | CC(CC(=O)N1CCC(O)(Cn2cnc(N3CC4CCOC4C3)cc2=O)CC1)c1ccccc1 |
| InChI | InChI=1S/C26H34N4O4/c1-19(20-5-3-2-4-6-20)13-24(31)28-10-8-26(33,9-11-28)17-30-18-27-23(14-25(30)32)29-15-21-7-12-34-22(21)16-29/h2-6,14,18-19,21-22,33H,7-13,15-17H2,1H3 |
| InChIKey | WTKVPIUMDJBDHB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |