C23H32N4O4 — CID 139414734
3-[[4-hydroxy-1-(3-phenylbutanoyl)piperidin-4-yl]methyl]-6-(2-methoxyethylamino)pyrimidin-4-one (PubChem CID 139414734) has the molecular formula C23H32N4O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 3-[[4-hydroxy-1-(3-phenylbutanoyl)piperidin-4-yl]methyl]-6-(2-methoxyethylamino)pyrimidin-4-one.
| Compound Name | 3-[[4-hydroxy-1-(3-phenylbutanoyl)piperidin-4-yl]methyl]-6-(2-methoxyethylamino)pyrimidin-4-one |
|---|---|
| PubChem CID | 139414734 |
| Molecular Formula | C23H32N4O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | 3-[[4-hydroxy-1-(3-phenylbutanoyl)piperidin-4-yl]methyl]-6-(2-methoxyethylamino)pyrimidin-4-one |
| SMILES | COCCNc1cc(=O)n(CC2(O)CCN(C(=O)CC(C)c3ccccc3)CC2)cn1 |
| InChI | InChI=1S/C23H32N4O4/c1-18(19-6-4-3-5-7-19)14-21(28)26-11-8-23(30,9-12-26)16-27-17-25-20(15-22(27)29)24-10-13-31-2/h3-7,15,17-18,24,30H,8-14,16H2,1-2H3 |
| InChIKey | QVPMLWJGHXDRIZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|