About 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane
5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane (PubChem CID 139415167) has the molecular formula C17H30O2
and a molecular weight of 266.42 g/mol. Its IUPAC name is 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane.
Molecular Properties
| Compound Name | 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane |
| PubChem CID | 139415167 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane |
| SMILES | CCC(C)C1(C)COC(C2CC=C(C)CC2C)OC1 |
| InChI | InChI=1S/C17H30O2/c1-6-14(4)17(5)10-18-16(19-11-17)15-8-7-12(2)9-13(15)3/h7,13-16H,6,8-11H2,1-5H3 |
| InChIKey | YTKJKKZXLPNIQF-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane?
The IUPAC name of 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane (CID 139415167) is 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane.
What is the SMILES notation for 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane?
The canonical SMILES for 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane is CCC(C)C1(C)COC(C2CC=C(C)CC2C)OC1.
What is the InChIKey of 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane?
The InChIKey is YTKJKKZXLPNIQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30O2/c1-6-14(4)17(5)10-18-16(19-11-17)15-8-7-12(2)9-13(15)3/h7,13-16H,6,8-11H2,1-5H3.
What are the key properties of 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane?
5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane has a molecular weight of 266.42 g/mol, XLogP of 4.40, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-2-(4,6-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane is sourced from PubChem (CID 139415167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).