About 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride (PubChem CID 139415809) has the molecular formula C21H26ClNO2
and a molecular weight of 359.90 g/mol. Its IUPAC name is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride.
Molecular Properties
| Compound Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride |
| PubChem CID | 139415809 |
| Molecular Formula | C21H26ClNO2 |
| Molecular Weight | 359.90 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride |
| SMILES | CC#Cc1cc(C)c(C2C(=O)CC3(CCNCC3)CC2=O)c(C)c1.Cl |
| InChI | InChI=1S/C21H25NO2.ClH/c1-4-5-16-10-14(2)19(15(3)11-16)20-17(23)12-21(13-18(20)24)6-8-22-9-7-21;/h10-11,20,22H,6-9,12-13H2,1-3H3;1H |
| InChIKey | NTJRJXMJWJEUJV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.90 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride?
The IUPAC name of 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride (CID 139415809) is 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride.
What is the SMILES notation for 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride?
The canonical SMILES for 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride is CC#Cc1cc(C)c(C2C(=O)CC3(CCNCC3)CC2=O)c(C)c1.Cl.
What is the InChIKey of 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride?
The InChIKey is NTJRJXMJWJEUJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25NO2.ClH/c1-4-5-16-10-14(2)19(15(3)11-16)20-17(23)12-21(13-18(20)24)6-8-22-9-7-21;/h10-11,20,22H,6-9,12-13H2,1-3H3;1H.
What are the key properties of 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride?
9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride has a molecular weight of 359.90 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(2,6-dimethyl-4-prop-1-ynylphenyl)-3-azaspiro[5.5]undecane-8,10-dione;hydrochloride is sourced from PubChem (CID 139415809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).