About N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide
N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide (PubChem CID 139416255) has the molecular formula C10H8BrClF3N3O2S
and a molecular weight of 406.61 g/mol. Its IUPAC name is N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide |
| PubChem CID | 139416255 |
| Molecular Formula | C10H8BrClF3N3O2S |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 404.92 |
| IUPAC Name | N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1nn(CC(F)(F)F)c2c(Br)ccc(Cl)c12 |
| InChI | InChI=1S/C10H8BrClF3N3O2S/c1-21(19,20)17-9-7-6(12)3-2-5(11)8(7)18(16-9)4-10(13,14)15/h2-3H,4H2,1H3,(H,16,17) |
| InChIKey | KHNWRPJGEJTXFT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide?
The IUPAC name of N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide (CID 139416255) is N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide.
What is the SMILES notation for N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide?
The canonical SMILES for N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide is CS(=O)(=O)Nc1nn(CC(F)(F)F)c2c(Br)ccc(Cl)c12.
What is the InChIKey of N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide?
The InChIKey is KHNWRPJGEJTXFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrClF3N3O2S/c1-21(19,20)17-9-7-6(12)3-2-5(11)8(7)18(16-9)4-10(13,14)15/h2-3H,4H2,1H3,(H,16,17).
What are the key properties of N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide?
N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide has a molecular weight of 406.61 g/mol, XLogP of 3.39, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[7-bromo-4-chloro-1-(2,2,2-trifluoroethyl)indazol-3-yl]methanesulfonamide is sourced from PubChem (CID 139416255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).