About 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide
2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide (PubChem CID 139416442) has the molecular formula C11H20N4O3S
and a molecular weight of 288.37 g/mol. Its IUPAC name is 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide.
Molecular Properties
| Compound Name | 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide |
| PubChem CID | 139416442 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide |
| SMILES | CC1(C)CC(OCCn2nccc2S(N)(=O)=O)CN1 |
| InChI | InChI=1S/C11H20N4O3S/c1-11(2)7-9(8-13-11)18-6-5-15-10(3-4-14-15)19(12,16)17/h3-4,9,13H,5-8H2,1-2H3,(H2,12,16,17) |
| InChIKey | ZXZFAJUWOPYJLG-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide?
The IUPAC name of 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide (CID 139416442) is 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide.
What is the SMILES notation for 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide?
The canonical SMILES for 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide is CC1(C)CC(OCCn2nccc2S(N)(=O)=O)CN1.
What is the InChIKey of 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide?
The InChIKey is ZXZFAJUWOPYJLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N4O3S/c1-11(2)7-9(8-13-11)18-6-5-15-10(3-4-14-15)19(12,16)17/h3-4,9,13H,5-8H2,1-2H3,(H2,12,16,17).
What are the key properties of 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide?
2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide has a molecular weight of 288.37 g/mol, XLogP of -0.31, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(5,5-dimethylpyrrolidin-3-yl)oxyethyl]pyrazole-3-sulfonamide is sourced from PubChem (CID 139416442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).